![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size |
|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | |
![[SND]](/icons/sound2.gif){kind=icon} | Chrysalis.mp3 | 2018-03-29 11:25 | 9.2M |
| Eye motion.mp3 | 2018-03-29 14:45 | 8.3M |
| Fuck the system.mp3 | 2018-03-28 18:09 | 5.1M |
| Future.mp3 | 2018-03-28 19:33 | 5.4M |
| Insane structure.mp3 | 2018-03-29 08:23 | 3.1M |
| My Robotic Pony Electronic Is Magic.mp3 | 2018-03-29 08:23 | 5.3M |
| Reboot.mp3 | 2018-03-28 19:33 | 8.1M |
| Shutting down.mp3 | 2018-03-29 11:25 | 6.0M |
| Soaring pegasus from the sky.mp3 | 2018-03-29 14:45 | 5.5M |